C16H15NO2 — CID 134969429
1-[(1R,2S)-2-methyl-2-phenylcyclopropyl]-3-nitrobenzene (PubChem CID 134969429) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methyl-2-phenylcyclopropyl]-3-nitrobenzene.
| Compound Name | 1-[(1R,2S)-2-methyl-2-phenylcyclopropyl]-3-nitrobenzene |
|---|---|
| PubChem CID | 134969429 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[(1R,2S)-2-methyl-2-phenylcyclopropyl]-3-nitrobenzene |
| SMILES | C[C@]1(c2ccccc2)C[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15NO2/c1-16(13-7-3-2-4-8-13)11-15(16)12-6-5-9-14(10-12)17(18)19/h2-10,15H,11H2,1H3/t15-,16-/m1/s1 |
| InChIKey | UTGSHCWOIIHSIP-HZPDHXFCSA-N |
| XLogP | 4.04 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|