About 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine
3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine (PubChem CID 164713943) has the molecular formula C7H5N3O2
and a molecular weight of 165.12 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine.
Molecular Properties
| Compound Name | 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine |
| PubChem CID | 164713943 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 165.12 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine |
| SMILES | O=[N+]([O-])c1cccc(C2[15N]=[15N]2)c1 |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)6-3-1-2-5(4-6)7-8-9-7/h1-4,7H/i8+1,9+1 |
| InChIKey | ZOCPZEKRQREXFZ-IOOOXAEESA-N |
| XLogP | 2.06 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine?
The IUPAC name of 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine (CID 164713943) is 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine.
What is the SMILES notation for 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine?
The canonical SMILES for 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine is O=[N+]([O-])c1cccc(C2[15N]=[15N]2)c1.
What is the InChIKey of 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine?
The InChIKey is ZOCPZEKRQREXFZ-IOOOXAEESA-N. The full InChI is InChI=1S/C7H5N3O2/c11-10(12)6-3-1-2-5(4-6)7-8-9-7/h1-4,7H/i8+1,9+1.
What are the key properties of 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine?
3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine has a molecular weight of 165.12 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-nitrophenyl)-(1,2-15N2)3H-diazirine is sourced from PubChem (CID 164713943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).