About 2-(3-nitrophenyl)-1,3-dioxole
2-(3-nitrophenyl)-1,3-dioxole (PubChem CID 141349380) has the molecular formula C9H7NO4
and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-1,3-dioxole.
Molecular Properties
| Compound Name | 2-(3-nitrophenyl)-1,3-dioxole |
| PubChem CID | 141349380 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-(3-nitrophenyl)-1,3-dioxole |
| SMILES | O=[N+]([O-])c1cccc(C2OC=CO2)c1 |
| InChI | InChI=1S/C9H7NO4/c11-10(12)8-3-1-2-7(6-8)9-13-4-5-14-9/h1-6,9H |
| InChIKey | FRMWXBVBGSWYDA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitrophenyl)-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitrophenyl)-1,3-dioxole?
The IUPAC name of 2-(3-nitrophenyl)-1,3-dioxole (CID 141349380) is 2-(3-nitrophenyl)-1,3-dioxole.
What is the SMILES notation for 2-(3-nitrophenyl)-1,3-dioxole?
The canonical SMILES for 2-(3-nitrophenyl)-1,3-dioxole is O=[N+]([O-])c1cccc(C2OC=CO2)c1.
What is the InChIKey of 2-(3-nitrophenyl)-1,3-dioxole?
The InChIKey is FRMWXBVBGSWYDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4/c11-10(12)8-3-1-2-7(6-8)9-13-4-5-14-9/h1-6,9H.
What are the key properties of 2-(3-nitrophenyl)-1,3-dioxole?
2-(3-nitrophenyl)-1,3-dioxole has a molecular weight of 193.16 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitrophenyl)-1,3-dioxole is sourced from PubChem (CID 141349380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).