C10H7N3O5 — CID 143152794
5-(3-nitrophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 143152794) has the molecular formula C10H7N3O5 and a molecular weight of 249.18 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(3-nitrophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 143152794 |
| Molecular Formula | C10H7N3O5 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 5-(3-nitrophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(c2cccc([N+](=O)[O-])c2)C(=O)N1 |
| InChI | InChI=1S/C10H7N3O5/c14-8-7(9(15)12-10(16)11-8)5-2-1-3-6(4-5)13(17)18/h1-4,7H,(H2,11,12,14,15,16) |
| InChIKey | BUWNPSBIKNXICU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|