C12H13N3O3 — CID 86334218
(6S)-6-(3-nitrophenyl)-5,8-diazaspiro[3.4]octan-7-one (PubChem CID 86334218) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is (6S)-6-(3-nitrophenyl)-5,8-diazaspiro[3.4]octan-7-one.
| Compound Name | (6S)-6-(3-nitrophenyl)-5,8-diazaspiro[3.4]octan-7-one |
|---|---|
| PubChem CID | 86334218 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (6S)-6-(3-nitrophenyl)-5,8-diazaspiro[3.4]octan-7-one |
| SMILES | O=C1NC2(CCC2)N[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O3/c16-11-10(13-12(14-11)5-2-6-12)8-3-1-4-9(7-8)15(17)18/h1,3-4,7,10,13H,2,5-6H2,(H,14,16)/t10-/m0/s1 |
| InChIKey | JXISYQMKVPPPJF-JTQLQIEISA-N |
| XLogP | 1.24 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|