C17H21Cl2N3O2 — CID 21499420
4-[2,2-dimethyl-5-(3-nitrophenyl)pyrrolidin-3-yl]pyridine;dihydrochloride (PubChem CID 21499420) has the molecular formula C17H21Cl2N3O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 4-[2,2-dimethyl-5-(3-nitrophenyl)pyrrolidin-3-yl]pyridine;dihydrochloride.
| Compound Name | 4-[2,2-dimethyl-5-(3-nitrophenyl)pyrrolidin-3-yl]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 21499420 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[2,2-dimethyl-5-(3-nitrophenyl)pyrrolidin-3-yl]pyridine;dihydrochloride |
| SMILES | CC1(C)NC(c2cccc([N+](=O)[O-])c2)CC1c1ccncc1.Cl.Cl |
| InChI | InChI=1S/C17H19N3O2.2ClH/c1-17(2)15(12-6-8-18-9-7-12)11-16(19-17)13-4-3-5-14(10-13)20(21)22;;/h3-10,15-16,19H,11H2,1-2H3;2*1H |
| InChIKey | TUOGGNUQLUCQJY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|