C14H15NO6 — CID 139350699
dimethyl 2-(3-nitrophenyl)cyclobutane-1,1-dicarboxylate (PubChem CID 139350699) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is dimethyl 2-(3-nitrophenyl)cyclobutane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-(3-nitrophenyl)cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139350699 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | dimethyl 2-(3-nitrophenyl)cyclobutane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCC1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15NO6/c1-20-12(16)14(13(17)21-2)7-6-11(14)9-4-3-5-10(8-9)15(18)19/h3-5,8,11H,6-7H2,1-2H3 |
| InChIKey | MAESNDPPUPICEF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|