C14H10Cl5NO3 — CID 10319819
(1R,4S,5R,7R)-1,2,3,4,7-pentachloro-7-methoxy-5-(3-nitrophenyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 10319819) has the molecular formula C14H10Cl5NO3 and a molecular weight of 417.50 g/mol. Its IUPAC name is (1R,4S,5R,7R)-1,2,3,4,7-pentachloro-7-methoxy-5-(3-nitrophenyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R,7R)-1,2,3,4,7-pentachloro-7-methoxy-5-(3-nitrophenyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10319819 |
| Molecular Formula | C14H10Cl5NO3 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | (1R,4S,5R,7R)-1,2,3,4,7-pentachloro-7-methoxy-5-(3-nitrophenyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CO[C@@]1(Cl)[C@@]2(Cl)C[C@H](c3cccc([N+](=O)[O-])c3)[C@]1(Cl)C(Cl)=C2Cl |
| InChI | InChI=1S/C14H10Cl5NO3/c1-23-14(19)12(17)6-9(13(14,18)11(16)10(12)15)7-3-2-4-8(5-7)20(21)22/h2-5,9H,6H2,1H3/t9-,12-,13+,14+/m1/s1 |
| InChIKey | ACTPDCRRVNLDQS-QQUHWDOBSA-N |
| XLogP | 5.32 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|