C22H21N3O9 — CID 15033949
dimethyl 1-methyl-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate (PubChem CID 15033949) has the molecular formula C22H21N3O9 and a molecular weight of 471.42 g/mol. Its IUPAC name is dimethyl 1-methyl-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl 1-methyl-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15033949 |
| Molecular Formula | C22H21N3O9 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | dimethyl 1-methyl-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)C(c2cccc([N+](=O)[O-])c2)N(C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H21N3O9/c1-23-18(12-6-4-8-14(10-12)24(29)30)16(21(27)33-2)20(26)17(22(28)34-3)19(23)13-7-5-9-15(11-13)25(31)32/h4-11,16-19H,1-3H3 |
| InChIKey | GTJBTERLCCILDZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|