C26H20ClN3O9 — CID 87616790
(2S,6R)-1-[(4-chlorophenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylic acid (PubChem CID 87616790) has the molecular formula C26H20ClN3O9 and a molecular weight of 553.91 g/mol. Its IUPAC name is (2S,6R)-1-[(4-chlorophenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylic acid.
| Compound Name | (2S,6R)-1-[(4-chlorophenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 87616790 |
| Molecular Formula | C26H20ClN3O9 |
| Molecular Weight | 553.91 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | (2S,6R)-1-[(4-chlorophenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1C(=O)C(C(=O)O)[C@@H](c2cccc([N+](=O)[O-])c2)N(Cc2ccc(Cl)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H20ClN3O9/c27-17-9-7-14(8-10-17)13-28-22(15-3-1-5-18(11-15)29(36)37)20(25(32)33)24(31)21(26(34)35)23(28)16-4-2-6-19(12-16)30(38)39/h1-12,20-23H,13H2,(H,32,33)(H,34,35)/t20?,21?,22-,23?/m1/s1 |
| InChIKey | DJLYDTQTCWCALF-FNSBAWCTSA-N |
| XLogP | 4.43 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|