C28H31ClN4O6 — CID 91452435
3-[3-[[2-[1-(4-chlorophenyl)cyclopentyl]-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91452435) has the molecular formula C28H31ClN4O6 and a molecular weight of 555.03 g/mol. Its IUPAC name is 3-[3-[[2-[1-(4-chlorophenyl)cyclopentyl]-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 3-[3-[[2-[1-(4-chlorophenyl)cyclopentyl]-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91452435 |
| Molecular Formula | C28H31ClN4O6 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 3-[3-[[2-[1-(4-chlorophenyl)cyclopentyl]-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=O)N(CCCNCC(=O)C2(c3ccc(Cl)cc3)CCCC2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C28H31ClN4O6/c1-18-24(26(35)36)25(19-6-4-7-22(16-19)33(38)39)32(27(37)31-18)15-5-14-30-17-23(34)28(12-2-3-13-28)20-8-10-21(29)11-9-20/h4,6-11,16,24-25,30H,2-3,5,12-15,17H2,1H3,(H,35,36) |
| InChIKey | SFRAYUNBXAEIMZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|