C23H26N4O8S — CID 91252488
3-[3-[(4-methoxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91252488) has the molecular formula C23H26N4O8S and a molecular weight of 518.55 g/mol. Its IUPAC name is 3-[3-[(4-methoxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 3-[3-[(4-methoxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91252488 |
| Molecular Formula | C23H26N4O8S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 3-[3-[(4-methoxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)CNCCCN2C(=O)N=C(C)C(C(=O)O)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H26N4O8S/c1-15-20(22(28)29)21(16-5-3-6-17(13-16)27(31)32)26(23(30)25-15)12-4-11-24-14-36(33,34)19-9-7-18(35-2)8-10-19/h3,5-10,13,20-21,24H,4,11-12,14H2,1-2H3,(H,28,29) |
| InChIKey | GVKXDFJXMGOSLT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 168.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|