C25H28N4O6 — CID 91064274
6-methyl-3-[3-[methyl(3-phenylpropanoyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91064274) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 6-methyl-3-[3-[methyl(3-phenylpropanoyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-3-[3-[methyl(3-phenylpropanoyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91064274 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 6-methyl-3-[3-[methyl(3-phenylpropanoyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=O)N(CCCN(C)C(=O)CCc2ccccc2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C25H28N4O6/c1-17-22(24(31)32)23(19-10-6-11-20(16-19)29(34)35)28(25(33)26-17)15-7-14-27(2)21(30)13-12-18-8-4-3-5-9-18/h3-6,8-11,16,22-23H,7,12-15H2,1-2H3,(H,31,32) |
| InChIKey | BEDKRWXQAFUCLE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|