C27H32N4O6 — CID 91485831
propan-2-yl 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 91485831) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is propan-2-yl 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91485831 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | propan-2-yl 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | CC(=O)N(CCCN1C(=O)N=C(C)C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N4O6/c1-18(2)37-26(33)24-19(3)28-27(34)30(25(24)22-12-8-13-23(16-22)31(35)36)15-9-14-29(20(4)32)17-21-10-6-5-7-11-21/h5-8,10-13,16,18,24-25H,9,14-15,17H2,1-4H3 |
| InChIKey | GPSXKKNGEKQLCN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|