C27H38N4O6 — CID 91050821
propan-2-yl 3-[3-[3-cyclopentylpropanoyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 91050821) has the molecular formula C27H38N4O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is propan-2-yl 3-[3-[3-cyclopentylpropanoyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[3-cyclopentylpropanoyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91050821 |
| Molecular Formula | C27H38N4O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | propan-2-yl 3-[3-[3-cyclopentylpropanoyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=NC(=O)N(CCCN(C)C(=O)CCC2CCCC2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C27H38N4O6/c1-18(2)37-26(33)24-19(3)28-27(34)30(25(24)21-11-7-12-22(17-21)31(35)36)16-8-15-29(4)23(32)14-13-20-9-5-6-10-20/h7,11-12,17-18,20,24-25H,5-6,8-10,13-16H2,1-4H3 |
| InChIKey | KPKVAXSQPZMYQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|