C23H23F3N4O7S — CID 91409606
6-methyl-3-[3-[methyl-[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91409606) has the molecular formula C23H23F3N4O7S and a molecular weight of 556.52 g/mol. Its IUPAC name is 6-methyl-3-[3-[methyl-[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-3-[3-[methyl-[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91409606 |
| Molecular Formula | C23H23F3N4O7S |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 6-methyl-3-[3-[methyl-[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=O)N(CCCN(C)S(=O)(=O)c2cccc(C(F)(F)F)c2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C23H23F3N4O7S/c1-14-19(21(31)32)20(15-6-3-8-17(12-15)30(34)35)29(22(33)27-14)11-5-10-28(2)38(36,37)18-9-4-7-16(13-18)23(24,25)26/h3-4,6-9,12-13,19-20H,5,10-11H2,1-2H3,(H,31,32) |
| InChIKey | KYIDYSOVMUXXOE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|