C23H24N4O9S — CID 90940420
3-[3-[(4-carboxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 90940420) has the molecular formula C23H24N4O9S and a molecular weight of 532.53 g/mol. Its IUPAC name is 3-[3-[(4-carboxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 3-[3-[(4-carboxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 90940420 |
| Molecular Formula | C23H24N4O9S |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 3-[3-[(4-carboxyphenyl)sulfonylmethylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=O)N(CCCNCS(=O)(=O)c2ccc(C(=O)O)cc2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C23H24N4O9S/c1-14-19(22(30)31)20(16-4-2-5-17(12-16)27(33)34)26(23(32)25-14)11-3-10-24-13-37(35,36)18-8-6-15(7-9-18)21(28)29/h2,4-9,12,19-20,24H,3,10-11,13H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | SBJXAMQGMCNTSO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 196.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|