C26H29FN4O6 — CID 91238099
propan-2-yl 3-[3-[[2-(4-fluorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 91238099) has the molecular formula C26H29FN4O6 and a molecular weight of 512.54 g/mol. Its IUPAC name is propan-2-yl 3-[3-[[2-(4-fluorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[[2-(4-fluorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91238099 |
| Molecular Formula | C26H29FN4O6 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | propan-2-yl 3-[3-[[2-(4-fluorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=NC(=O)N(CCCNCC(=O)c2ccc(F)cc2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C26H29FN4O6/c1-16(2)37-25(33)23-17(3)29-26(34)30(24(23)19-6-4-7-21(14-19)31(35)36)13-5-12-28-15-22(32)18-8-10-20(27)11-9-18/h4,6-11,14,16,23-24,28H,5,12-13,15H2,1-3H3 |
| InChIKey | RLJGSWJSUDUMSU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|