C25H30N4O7S — CID 90894795
propan-2-yl 3-[3-[benzenesulfonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 90894795) has the molecular formula C25H30N4O7S and a molecular weight of 530.60 g/mol. Its IUPAC name is propan-2-yl 3-[3-[benzenesulfonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[benzenesulfonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90894795 |
| Molecular Formula | C25H30N4O7S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | propan-2-yl 3-[3-[benzenesulfonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=NC(=O)N(CCCN(C)S(=O)(=O)c2ccccc2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C25H30N4O7S/c1-17(2)36-24(30)22-18(3)26-25(31)28(23(22)19-10-8-11-20(16-19)29(32)33)15-9-14-27(4)37(34,35)21-12-6-5-7-13-21/h5-8,10-13,16-17,22-23H,9,14-15H2,1-4H3 |
| InChIKey | HLIFHOBOPGHYMZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 139.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|