C23H26N4O7S — CID 91522606
6-methyl-3-[3-[methyl-(4-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91522606) has the molecular formula C23H26N4O7S and a molecular weight of 502.55 g/mol. Its IUPAC name is 6-methyl-3-[3-[methyl-(4-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-3-[3-[methyl-(4-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91522606 |
| Molecular Formula | C23H26N4O7S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 6-methyl-3-[3-[methyl-(4-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=O)N(CCCN(C)S(=O)(=O)c2ccc(C)cc2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C23H26N4O7S/c1-15-8-10-19(11-9-15)35(33,34)25(3)12-5-13-26-21(17-6-4-7-18(14-17)27(31)32)20(22(28)29)16(2)24-23(26)30/h4,6-11,14,20-21H,5,12-13H2,1-3H3,(H,28,29) |
| InChIKey | PVCBNMDNICULGF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|