C24H26N4O6 — CID 91568547
3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91568547) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91568547 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3-[3-[acetyl(benzyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC(=O)N(CCCN1C(=O)N=C(C)C(C(=O)O)C1c1cccc([N+](=O)[O-])c1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26N4O6/c1-16-21(23(30)31)22(19-10-6-11-20(14-19)28(33)34)27(24(32)25-16)13-7-12-26(17(2)29)15-18-8-4-3-5-9-18/h3-6,8-11,14,21-22H,7,12-13,15H2,1-2H3,(H,30,31) |
| InChIKey | DGJKUTJGENYQSM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|