C25H28N4O6 — CID 91044627
3-[3-[[2-(2,3-dimethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 91044627) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-[3-[[2-(2,3-dimethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 3-[3-[[2-(2,3-dimethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 91044627 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[3-[[2-(2,3-dimethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=NC(=O)N(CCCNCC(=O)c2cccc(C)c2C)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C25H28N4O6/c1-15-7-4-10-20(16(15)2)21(30)14-26-11-6-12-28-23(18-8-5-9-19(13-18)29(34)35)22(24(31)32)17(3)27-25(28)33/h4-5,7-10,13,22-23,26H,6,11-12,14H2,1-3H3,(H,31,32) |
| InChIKey | WCLUQSNMZYDSPU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|