C28H34N4O6 — CID 91134493
propan-2-yl 3-[3-[[2-(4-ethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 91134493) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is propan-2-yl 3-[3-[[2-(4-ethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[[2-(4-ethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91134493 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | propan-2-yl 3-[3-[[2-(4-ethylphenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | CCc1ccc(C(=O)CNCCCN2C(=O)N=C(C)C(C(=O)OC(C)C)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H34N4O6/c1-5-20-10-12-21(13-11-20)24(33)17-29-14-7-15-31-26(22-8-6-9-23(16-22)32(36)37)25(19(4)30-28(31)35)27(34)38-18(2)3/h6,8-13,16,18,25-26,29H,5,7,14-15,17H2,1-4H3 |
| InChIKey | WFEVIWSFLLOYGR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|