C17H10ClNO6 — CID 98381913
(4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-nitrophenyl)oxolane-2,3-dione (PubChem CID 98381913) has the molecular formula C17H10ClNO6 and a molecular weight of 359.72 g/mol. Its IUPAC name is (4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-nitrophenyl)oxolane-2,3-dione.
| Compound Name | (4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-nitrophenyl)oxolane-2,3-dione |
|---|---|
| PubChem CID | 98381913 |
| Molecular Formula | C17H10ClNO6 |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-nitrophenyl)oxolane-2,3-dione |
| SMILES | O=C1O[C@@H](c2cccc([N+](=O)[O-])c2)/C(=C(\O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H10ClNO6/c18-11-6-4-9(5-7-11)14(20)13-15(21)17(22)25-16(13)10-2-1-3-12(8-10)19(23)24/h1-8,16,20H/b14-13-/t16-/m0/s1 |
| InChIKey | ZXUMCKDJBBAFKA-FIPLFPIMSA-N |
| XLogP | 3.38 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|