C17H11NO6 — CID 7113811
(4E,5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)oxolane-2,3-dione (PubChem CID 7113811) has the molecular formula C17H11NO6 and a molecular weight of 325.28 g/mol. Its IUPAC name is (4E,5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)oxolane-2,3-dione.
| Compound Name | (4E,5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)oxolane-2,3-dione |
|---|---|
| PubChem CID | 7113811 |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (4E,5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)oxolane-2,3-dione |
| SMILES | O=C1O[C@H](c2cccc([N+](=O)[O-])c2)/C(=C(\O)c2ccccc2)C1=O |
| InChI | InChI=1S/C17H11NO6/c19-14(10-5-2-1-3-6-10)13-15(20)17(21)24-16(13)11-7-4-8-12(9-11)18(22)23/h1-9,16,19H/b14-13-/t16-/m1/s1 |
| InChIKey | VCVWSRHVMHLGJU-OMACXJQVSA-N |
| XLogP | 2.73 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|