C25H16ClN3O5S — CID 6120004
(4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 6120004) has the molecular formula C25H16ClN3O5S and a molecular weight of 505.94 g/mol. Its IUPAC name is (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6120004 |
| Molecular Formula | C25H16ClN3O5S |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(Cl)cc4)C3c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C25H16ClN3O5S/c1-13-5-10-18-19(11-13)35-25(27-18)28-21(15-3-2-4-17(12-15)29(33)34)20(23(31)24(28)32)22(30)14-6-8-16(26)9-7-14/h2-12,21,30H,1H3/b22-20+ |
| InChIKey | YEURTEGGEZMPNU-LSDHQDQOSA-N |
| XLogP | 5.79 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|