C25H15F2N3O5S — CID 108714627
(4E)-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714627) has the molecular formula C25H15F2N3O5S and a molecular weight of 507.47 g/mol. Its IUPAC name is (4E)-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714627 |
| Molecular Formula | C25H15F2N3O5S |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | (4E)-1-(5,6-difluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(C2/C(=C(\O)c3ccc([N+](=O)[O-])cc3)C(=O)C(=O)N2c2nc3cc(F)c(F)cc3s2)c1 |
| InChI | InChI=1S/C25H15F2N3O5S/c1-12-3-2-4-14(9-12)21-20(22(31)13-5-7-15(8-6-13)30(34)35)23(32)24(33)29(21)25-28-18-10-16(26)17(27)11-19(18)36-25/h2-11,21,31H,1H3/b22-20+ |
| InChIKey | NMIXUBQHBGYTPF-LSDHQDQOSA-N |
| XLogP | 5.42 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|