C17H14N2O5S — CID 10089760
2,6-bis(3-nitrophenyl)thian-4-one (PubChem CID 10089760) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 2,6-bis(3-nitrophenyl)thian-4-one.
| Compound Name | 2,6-bis(3-nitrophenyl)thian-4-one |
|---|---|
| PubChem CID | 10089760 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2,6-bis(3-nitrophenyl)thian-4-one |
| SMILES | O=C1CC(c2cccc([N+](=O)[O-])c2)SC(c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C17H14N2O5S/c20-15-9-16(11-3-1-5-13(7-11)18(21)22)25-17(10-15)12-4-2-6-14(8-12)19(23)24/h1-8,16-17H,9-10H2 |
| InChIKey | GEHPHNXZQJBELR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|