C15H11NO4 — CID 10084425
2-(3-nitrophenyl)-2,3-dihydrochromen-4-one (PubChem CID 10084425) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3-nitrophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 10084425 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(3-nitrophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cccc([N+](=O)[O-])c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H11NO4/c17-13-9-15(20-14-7-2-1-6-12(13)14)10-4-3-5-11(8-10)16(18)19/h1-8,15H,9H2 |
| InChIKey | HMHLDZDEZCGZRA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|