C15H13BO4 — CID 71504747
[3-(4-oxo-2,3-dihydrochromen-2-yl)phenyl]boronic acid (PubChem CID 71504747) has the molecular formula C15H13BO4 and a molecular weight of 268.08 g/mol. Its IUPAC name is [3-(4-oxo-2,3-dihydrochromen-2-yl)phenyl]boronic acid.
| Compound Name | [3-(4-oxo-2,3-dihydrochromen-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 71504747 |
| Molecular Formula | C15H13BO4 |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [3-(4-oxo-2,3-dihydrochromen-2-yl)phenyl]boronic acid |
| SMILES | O=C1CC(c2cccc(B(O)O)c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H13BO4/c17-13-9-15(20-14-7-2-1-6-12(13)14)10-4-3-5-11(8-10)16(18)19/h1-8,15,18-19H,9H2 |
| InChIKey | FJDJMZIFPZOJLN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|