C15H10BrClO2 — CID 114671437
2-(3-bromo-4-chlorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 114671437) has the molecular formula C15H10BrClO2 and a molecular weight of 337.60 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114671437 |
| Molecular Formula | C15H10BrClO2 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccc(Cl)c(Br)c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H10BrClO2/c16-11-7-9(5-6-12(11)17)15-8-13(18)10-3-1-2-4-14(10)19-15/h1-7,15H,8H2 |
| InChIKey | OCDFQAFRCAROHG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |