C30H22N2O10 — CID 157444606
6-hydroxy-2-(3-nitrophenyl)-2,3-dihydrochromen-4-one (PubChem CID 157444606) has the molecular formula C30H22N2O10 and a molecular weight of 570.51 g/mol. Its IUPAC name is 6-hydroxy-2-(3-nitrophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-hydroxy-2-(3-nitrophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 157444606 |
| Molecular Formula | C30H22N2O10 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 6-hydroxy-2-(3-nitrophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cccc([N+](=O)[O-])c2)Oc2ccc(O)cc21.O=C1CC(c2cccc([N+](=O)[O-])c2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/2C15H11NO5/c2*17-11-4-5-14-12(7-11)13(18)8-15(21-14)9-2-1-3-10(6-9)16(19)20/h2*1-7,15,17H,8H2 |
| InChIKey | BSBOCHRETPMYPT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 179.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|