C30H26N2O10 — CID 158773048
2-(3-nitrophenyl)-3,4-dihydro-2H-chromene-4,6-diol (PubChem CID 158773048) has the molecular formula C30H26N2O10 and a molecular weight of 574.54 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-3,4-dihydro-2H-chromene-4,6-diol.
| Compound Name | 2-(3-nitrophenyl)-3,4-dihydro-2H-chromene-4,6-diol |
|---|---|
| PubChem CID | 158773048 |
| Molecular Formula | C30H26N2O10 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 2-(3-nitrophenyl)-3,4-dihydro-2H-chromene-4,6-diol |
| SMILES | O=[N+]([O-])c1cccc(C2CC(O)c3cc(O)ccc3O2)c1.O=[N+]([O-])c1cccc(C2CC(O)c3cc(O)ccc3O2)c1 |
| InChI | InChI=1S/2C15H13NO5/c2*17-11-4-5-14-12(7-11)13(18)8-15(21-14)9-2-1-3-10(6-9)16(19)20/h2*1-7,13,15,17-18H,8H2 |
| InChIKey | IQCSEHZLWBLPBE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|