C16H16O4 — CID 114714377
2-(3-hydroxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714377) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(3-hydroxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714377 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(3-hydroxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)OC(c1cccc(O)c1)CC2O |
| InChI | InChI=1S/C16H16O4/c1-19-12-5-6-13-14(18)9-15(20-16(13)8-12)10-3-2-4-11(17)7-10/h2-8,14-15,17-18H,9H2,1H3 |
| InChIKey | FYHIIXZGTLMHHV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |