C22H20O4 — CID 69262999
2-(3-hydroxyphenyl)-4-(3-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 69262999) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-4-(3-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 2-(3-hydroxyphenyl)-4-(3-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 69262999 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(3-hydroxyphenyl)-4-(3-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | COc1cccc(C2CC(c3cccc(O)c3)Oc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C22H20O4/c1-25-18-7-3-4-14(11-18)20-13-21(15-5-2-6-16(23)10-15)26-22-12-17(24)8-9-19(20)22/h2-12,20-21,23-24H,13H2,1H3 |
| InChIKey | NCGBXKPGMPONEQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |