C16H17NO2 — CID 104944729
(4R)-7-methoxy-2-phenyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104944729) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (4R)-7-methoxy-2-phenyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-7-methoxy-2-phenyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104944729 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (4R)-7-methoxy-2-phenyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)OC(c1ccccc1)C[C@H]2N |
| InChI | InChI=1S/C16H17NO2/c1-18-12-7-8-13-14(17)10-15(19-16(13)9-12)11-5-3-2-4-6-11/h2-9,14-15H,10,17H2,1H3/t14-,15?/m1/s1 |
| InChIKey | VGWFTIXHEMPXFG-GICMACPYSA-N |
| XLogP | 3.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |