C16H17NO3 — CID 114708803
4-(4-amino-7-methoxy-3,4-dihydro-2H-chromen-2-yl)phenol (PubChem CID 114708803) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-(4-amino-7-methoxy-3,4-dihydro-2H-chromen-2-yl)phenol.
| Compound Name | 4-(4-amino-7-methoxy-3,4-dihydro-2H-chromen-2-yl)phenol |
|---|---|
| PubChem CID | 114708803 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-(4-amino-7-methoxy-3,4-dihydro-2H-chromen-2-yl)phenol |
| SMILES | COc1ccc2c(c1)OC(c1ccc(O)cc1)CC2N |
| InChI | InChI=1S/C16H17NO3/c1-19-12-6-7-13-14(17)9-15(20-16(13)8-12)10-2-4-11(18)5-3-10/h2-8,14-15,18H,9,17H2,1H3 |
| InChIKey | WHJRTCTXLAIHOM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |