C16H15F2NO2 — CID 104944865
(4R)-2-(3,4-difluorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104944865) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is (4R)-2-(3,4-difluorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-(3,4-difluorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104944865 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (4R)-2-(3,4-difluorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)OC(c1ccc(F)c(F)c1)C[C@H]2N |
| InChI | InChI=1S/C16H15F2NO2/c1-20-10-3-4-11-14(19)8-15(21-16(11)7-10)9-2-5-12(17)13(18)6-9/h2-7,14-15H,8,19H2,1H3/t14-,15?/m1/s1 |
| InChIKey | HPCXRDSEKBQWBH-GICMACPYSA-N |
| XLogP | 3.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |