C18H18O5 — CID 821291
[3-[(2R,4S)-4-hydroxy-7-methoxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate (PubChem CID 821291) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is [3-[(2R,4S)-4-hydroxy-7-methoxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate.
| Compound Name | [3-[(2R,4S)-4-hydroxy-7-methoxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 821291 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [3-[(2R,4S)-4-hydroxy-7-methoxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate |
| SMILES | COc1ccc2c(c1)O[C@@H](c1cccc(OC(C)=O)c1)C[C@@H]2O |
| InChI | InChI=1S/C18H18O5/c1-11(19)22-14-5-3-4-12(8-14)17-10-16(20)15-7-6-13(21-2)9-18(15)23-17/h3-9,16-17,20H,10H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | UORGIJVGXRVGCF-DLBZAZTESA-N |
| XLogP | 3.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|