C16H14BrClO3 — CID 114714248
2-(3-bromo-4-chlorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714248) has the molecular formula C16H14BrClO3 and a molecular weight of 369.64 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714248 |
| Molecular Formula | C16H14BrClO3 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)OC(c1ccc(Cl)c(Br)c1)CC2O |
| InChI | InChI=1S/C16H14BrClO3/c1-20-10-3-4-11-14(19)8-15(21-16(11)7-10)9-2-5-13(18)12(17)6-9/h2-7,14-15,19H,8H2,1H3 |
| InChIKey | WGHIRTIGCYXKFL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |