C14H13BrO3S — CID 114714221
2-(3-bromothiophen-2-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714221) has the molecular formula C14H13BrO3S and a molecular weight of 341.23 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(3-bromothiophen-2-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714221 |
| Molecular Formula | C14H13BrO3S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)OC(c1sccc1Br)CC2O |
| InChI | InChI=1S/C14H13BrO3S/c1-17-8-2-3-9-11(16)7-13(18-12(9)6-8)14-10(15)4-5-19-14/h2-6,11,13,16H,7H2,1H3 |
| InChIKey | FMPNRKNVZFWYQB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |