C13H10Br2O2S — CID 104951117
(4S)-6-bromo-2-(3-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951117) has the molecular formula C13H10Br2O2S and a molecular weight of 390.10 g/mol. Its IUPAC name is (4S)-6-bromo-2-(3-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-6-bromo-2-(3-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951117 |
| Molecular Formula | C13H10Br2O2S |
| Molecular Weight | 390.10 g/mol |
| Exact Mass | 387.88 |
| IUPAC Name | (4S)-6-bromo-2-(3-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1CC(c2sccc2Br)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H10Br2O2S/c14-7-1-2-11-8(5-7)10(16)6-12(17-11)13-9(15)3-4-18-13/h1-5,10,12,16H,6H2/t10-,12?/m0/s1 |
| InChIKey | QRPPAVAXCXMEQE-NUHJPDEHSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.10 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |