C16H15BrO2S — CID 104951096
(4S)-6-bromo-2-(4-methylsulfanylphenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951096) has the molecular formula C16H15BrO2S and a molecular weight of 351.27 g/mol. Its IUPAC name is (4S)-6-bromo-2-(4-methylsulfanylphenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-6-bromo-2-(4-methylsulfanylphenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951096 |
| Molecular Formula | C16H15BrO2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | (4S)-6-bromo-2-(4-methylsulfanylphenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CSc1ccc(C2C[C@H](O)c3cc(Br)ccc3O2)cc1 |
| InChI | InChI=1S/C16H15BrO2S/c1-20-12-5-2-10(3-6-12)16-9-14(18)13-8-11(17)4-7-15(13)19-16/h2-8,14,16,18H,9H2,1H3/t14-,16?/m0/s1 |
| InChIKey | OMWKDKYIPHKCTG-LBAUFKAWSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |