C16H14BrFO2 — CID 104951447
(4R)-6-bromo-2-(4-fluoro-3-methylphenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951447) has the molecular formula C16H14BrFO2 and a molecular weight of 337.19 g/mol. Its IUPAC name is (4R)-6-bromo-2-(4-fluoro-3-methylphenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-6-bromo-2-(4-fluoro-3-methylphenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951447 |
| Molecular Formula | C16H14BrFO2 |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | (4R)-6-bromo-2-(4-fluoro-3-methylphenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1cc(C2C[C@@H](O)c3cc(Br)ccc3O2)ccc1F |
| InChI | InChI=1S/C16H14BrFO2/c1-9-6-10(2-4-13(9)18)16-8-14(19)12-7-11(17)3-5-15(12)20-16/h2-7,14,16,19H,8H2,1H3/t14-,16?/m1/s1 |
| InChIKey | YVYJHJVWSNGAFL-IURRXHLWSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |