C16H14O3 — CID 174481286
6-hydroxy-2-phenyl-3,4-dihydro-2H-chromene-4-carbaldehyde (PubChem CID 174481286) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-hydroxy-2-phenyl-3,4-dihydro-2H-chromene-4-carbaldehyde.
| Compound Name | 6-hydroxy-2-phenyl-3,4-dihydro-2H-chromene-4-carbaldehyde |
|---|---|
| PubChem CID | 174481286 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-hydroxy-2-phenyl-3,4-dihydro-2H-chromene-4-carbaldehyde |
| SMILES | O=CC1CC(c2ccccc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C16H14O3/c17-10-12-8-16(11-4-2-1-3-5-11)19-15-7-6-13(18)9-14(12)15/h1-7,9-10,12,16,18H,8H2 |
| InChIKey | ZAYHZIHMMBSVKD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|