C16H16O3S — CID 147786035
(2R,4R)-2-(4-hydroxyphenyl)-4-(sulfanylmethyl)-3,4-dihydro-2H-chromen-6-ol (PubChem CID 147786035) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is (2R,4R)-2-(4-hydroxyphenyl)-4-(sulfanylmethyl)-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (2R,4R)-2-(4-hydroxyphenyl)-4-(sulfanylmethyl)-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 147786035 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (2R,4R)-2-(4-hydroxyphenyl)-4-(sulfanylmethyl)-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1ccc([C@H]2C[C@@H](CS)c3cc(O)ccc3O2)cc1 |
| InChI | InChI=1S/C16H16O3S/c17-12-3-1-10(2-4-12)16-7-11(9-20)14-8-13(18)5-6-15(14)19-16/h1-6,8,11,16-18,20H,7,9H2/t11-,16+/m0/s1 |
| InChIKey | HIRZIBMBBCBEPW-MEDUHNTESA-N |
| XLogP | 3.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|