About 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol
2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol (PubChem CID 157484623) has the molecular formula C30H26F2O6
and a molecular weight of 520.53 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol |
| PubChem CID | 157484623 |
| Molecular Formula | C30H26F2O6 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol |
| SMILES | Oc1ccc2c(c1)C(O)CC(c1cccc(F)c1)O2.Oc1ccc2c(c1)C(O)CC(c1cccc(F)c1)O2 |
| InChI | InChI=1S/2C15H13FO3/c2*16-10-3-1-2-9(6-10)15-8-13(18)12-7-11(17)4-5-14(12)19-15/h2*1-7,13,15,17-18H,8H2 |
| InChIKey | BWOGHMQOIARSCQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol?
The IUPAC name of 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol (CID 157484623) is 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol.
What is the SMILES notation for 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol?
The canonical SMILES for 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol is Oc1ccc2c(c1)C(O)CC(c1cccc(F)c1)O2.Oc1ccc2c(c1)C(O)CC(c1cccc(F)c1)O2.
What is the InChIKey of 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol?
The InChIKey is BWOGHMQOIARSCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H13FO3/c2*16-10-3-1-2-9(6-10)15-8-13(18)12-7-11(17)4-5-14(12)19-15/h2*1-7,13,15,17-18H,8H2.
What are the key properties of 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol?
2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol has a molecular weight of 520.53 g/mol, XLogP of 6.18, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol is sourced from PubChem (CID 157484623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).