C30H26F2O6 — CID 157484623
2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol (PubChem CID 157484623) has the molecular formula C30H26F2O6 and a molecular weight of 520.53 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol.
| Compound Name | 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol |
|---|---|
| PubChem CID | 157484623 |
| Molecular Formula | C30H26F2O6 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-(3-fluorophenyl)-3,4-dihydro-2H-chromene-4,6-diol |
| SMILES | Oc1ccc2c(c1)C(O)CC(c1cccc(F)c1)O2.Oc1ccc2c(c1)C(O)CC(c1cccc(F)c1)O2 |
| InChI | InChI=1S/2C15H13FO3/c2*16-10-3-1-2-9(6-10)15-8-13(18)12-7-11(17)4-5-14(12)19-15/h2*1-7,13,15,17-18H,8H2 |
| InChIKey | BWOGHMQOIARSCQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |