C15H13FO2 — CID 104951796
(4S)-7-fluoro-2-phenyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951796) has the molecular formula C15H13FO2 and a molecular weight of 244.27 g/mol. Its IUPAC name is (4S)-7-fluoro-2-phenyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-7-fluoro-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951796 |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (4S)-7-fluoro-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1CC(c2ccccc2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C15H13FO2/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-8,13-14,17H,9H2/t13-,14?/m0/s1 |
| InChIKey | PBSIEPAOVYDMTK-LSLKUGRBSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |