C15H11Cl2FO2 — CID 104951630
(4R)-2-(2,6-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951630) has the molecular formula C15H11Cl2FO2 and a molecular weight of 313.16 g/mol. Its IUPAC name is (4R)-2-(2,6-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-2-(2,6-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951630 |
| Molecular Formula | C15H11Cl2FO2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | (4R)-2-(2,6-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@@H]1CC(c2c(Cl)cccc2Cl)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C15H11Cl2FO2/c16-10-2-1-3-11(17)15(10)14-7-12(19)9-5-4-8(18)6-13(9)20-14/h1-6,12,14,19H,7H2/t12-,14?/m1/s1 |
| InChIKey | SYKDZTDSHDIVJF-PUODRLBUSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |