C15H11BrClFO2 — CID 114715610
6-bromo-2-(2-chloro-6-fluorophenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715610) has the molecular formula C15H11BrClFO2 and a molecular weight of 357.61 g/mol. Its IUPAC name is 6-bromo-2-(2-chloro-6-fluorophenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-bromo-2-(2-chloro-6-fluorophenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715610 |
| Molecular Formula | C15H11BrClFO2 |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 6-bromo-2-(2-chloro-6-fluorophenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(c2c(F)cccc2Cl)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H11BrClFO2/c16-8-4-5-13-9(6-8)12(19)7-14(20-13)15-10(17)2-1-3-11(15)18/h1-6,12,14,19H,7H2 |
| InChIKey | YCRZCZOVZGNOPP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |